| Identification | |
| Name: | N,N-Dimethylbenzylamine |
| Synonyms: | BDMA; N-Benzyldimethylamine,(N,N-Dimethylbenzylamine); Dimethylbenzylamine,98%; N-Benzyldimethylamine; Nin-Dimethyl Benzylamine; Araldite accelerator 062; aralditeaccelerator062; Benzenemethamine, N,N-dimethyl-; Benzenemethanamine,N,N-dimethyl-; Benzylamine, N,N-dimethyl-; Benzyl-N,N-dimethylamine; Dabco B-16; N-(Phenylmethyl)dimethylamine; N, N-dimethylbenzylamine; N,N-Dimethyl benzylamine; N,N-BENZYLDIMETHYLAMINE; BENZYLDIMETHYLAMINE; BENZYLDIMETHYLAMINE |
| CAS: | 103-83-3 |
| EINECS: | 203-149-1 |
| Molecular Formula: | C9H13N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2619 |
| Density: | 0.9 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.5-1.502 |
| Appearance: | A colorless to light yellow liquid with an ammonia odor. |
| Specification: |
?N,N-Dimethylbenzylamine , its CAS NO. is 103-83-3, the synonyms are Araldite accelerator 062 ; Aralditeaccelerator062 ; Benzenemethamine, N,N-dimethyl- ; Benzenemethanamine,N,N-dimethyl- ; Benzylamine, N,N-dimethyl- ; Benzyl-N,N-dimethylamine ; Dabco B-16 ; N-(Phenylmethyl)dimethylamine . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29214980 |
| Storage Temperature: | Flammables area |
| Usage: | Used in the manufacture of adhesives and other chemicals. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
