Identification |
Name: | 4'-methylacetanilide |
Synonyms: | p-Acetotoluidide |
CAS: | 103-89-9 |
EINECS: | 203-155-4 |
Molecular Formula: | C9H11NO |
Molecular Weight: | 149.19 |
InChI: | InChI=1/C9H11NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Density: | 1.212 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.567 |
Solubility: | slightly
SOLVENT |
Appearance: | off white to brown flake |
Specification: | BEIGE TO LIGHT BROWN CRYSTALS OR CRYST. POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
HS Code: | 29242995 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |