| Identification | |
| Name: | Isoquinoline,1,2,3,4-tetrahydro-5-methoxy-, hydrochloride (1:1) |
| Synonyms: | Isoquinoline,1,2,3,4-tetrahydro-5-methoxy-, hydrochloride (6CI,9CI);5-Methoxy-1,2,3,4-tetrahydroisoquinolinehydrochloride;5-Methoxy-1,2,3,4-Tetrahydroisoquinoline Hydrochloride; |
| CAS: | 103030-69-9 |
| Molecular Formula: | C10H13NO.HCl |
| Molecular Weight: | 199.67726 |
| InChI: | InChI=1/C10H13NO.ClH/c1-12-10-4-2-3-8-7-11-6-5-9(8)10;/h2-4,11H,5-7H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 5-Methoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride, with CAS registry number 103030-69-9, has the systematic name of 5-methoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride. And the chemical formula of this chemical is C10H13NO.HCl. Physical properties about this chemical are: (1)ACD/LogP: 1.32; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1.01; (7)#H bond acceptors: 2; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 21.26 Å2; (11)Enthalpy of Vaporization: 58 kJ/mol; (12)Vapour Pressure: 0.000156 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
