| Identification | |
| Name: | Butanoic acid,2-methyl-, methyl ester, (2S)- |
| Synonyms: | Butanoicacid, 2-methyl-, methyl ester, (S)-;Butyric acid, 2-methyl-, methyl ester,(+)- (8CI);(+)-Methyl 2-methylbutanoate;(+)-Methyl 2-methylbutyrate;(+)-Methyl a-methylbutyrate;(S)-2-Methylbutanoic acid methyl ester;(S)-Methyl 2-methylbutanoate;Methyl(2S)-2-methylbutanoate;Methyl (S)-2-methylbutyrate;(S)-2-Methylbutanoic acid methyl ester; Methyl (2S)-2-methylbutanoate; |
| CAS: | 10307-60-5 |
| EINECS: | 212-778-0 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-4-5(2)6(7)8-3/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 19 ºC |
| Boiling Point: | 113 ºC |
| Density: | 0.883 |
| Refractive index: | 1.395 |
| Specification: |
The cas register number of (S)-Methyl 2-methylbutyrate is 10307-60-5. It also can be called as (S)-2-Methylbutanoic acid methyl ester; Methyl (2S)-2-methylbutanoate and the Systematic name about this chemical is methyl 2-methylbutanoate. Physical properties about (S)-Methyl 2-methylbutyrate are: (1)ACD/LogP: 1.59; (2)ACD/LogD (pH 5.5): 1.59; (3)ACD/LogD (pH 7.4): 1.59; (4)ACD/BCF (pH 5.5): 9.47; (5)ACD/BCF (pH 7.4): 9.47; (6)ACD/KOC (pH 5.5): 173.93; (7)ACD/KOC (pH 7.4): 173.93; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 26.3Å2; (11)Index of Refraction: 1.395; (12)Molar Refractivity: 31.57 cm3; (13)Molar Volume: 131.4 cm3; (14)Polarizability: 12.51x10-24cm3; (15)Surface Tension: 24.6 dyne/cm; (16)Enthalpy of Vaporization: 35.11 kJ/mol; (17)Boiling Point: 112.6 °C at 760 mmHg; (18)Vapour Pressure: 21.6 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 19 ºC |
| Safety Data | |
 |
|
