Identification |
Name: | Propanoic acid,2-hydroxy-, (2R)- |
Synonyms: | Lacticacid, D- (8CI);Propanoic acid, 2-hydroxy-, (R)-;(-)-Lactic acid;(2R)-2-Hydroxypropanoic acid;(R)-(-)-Lacticacid;(R)-2-Hydroxypropanoic acid;(R)-2-Hydroxypropionic acid;(R)-Lactic acid;(R)-a-Hydroxypropionic acid;D-(-)-Lactic acid;D-Lacticacid; |
CAS: | 10326-41-7 |
EINECS: | 233-713-2 |
Molecular Formula: | C3H6O3 |
Molecular Weight: | 90.08 |
InChI: | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m1/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.276g/cm3 |
Refractive index: | 1.451 |
Solubility: | Miscible with alcohol, glycerol, and furfural Soluble in alcohol and furfurol; slightly soluble in ether; insoluble in chloroform, petroleum ether, carbon disulfide. Miscible in alcohol-ether solution. In water, miscible |
Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |