| Identification | |
| Name: | Salidroside |
| Synonyms: | RHODIOLOSIDE ; beta-d-glucopyranoside,2-(4-hydroxyphenyl)ethyl ; glucopyranoside,p-hydroxyphenethyl ; rhodosin ; 2-(4-HYDROXYPHENYL)ETHYL-BETA-D-GLUCOPYRANOSIDE ; TWEEN 20 EXTRA PURE ; SALIDROSIDE 98+% BY HPLC ; RhodiolaCrenulataExtract ; SALIDROSIDE(P) ; Rhodiola Rosea(3%Rosavin, 1%Salidroside); Rhodiola Extract; Rhodiola rosea extract |
| CAS: | 10338-51-9 |
| Molecular Formula: | C14H20O7 |
| Molecular Weight: | 300.31 |
| InChI: | InChI=1/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.46 g/cm3 |
| Refractive index: | 1.628 |
| Appearance: | red-brown fine powder |
| Specification: |
?Salidroside , its cas register number is 10338-51-9. It also can be called Rhodioloside . Salidroside (CAS NO.10338-51-9) is a glycoside compound found in the plant Rhodiola rosea. |
| Safety Data | |
 |
|
