| Identification | |
| Name: | octyl gallate |
| Synonyms: | n-Octyl gallate; octyl 3,4,5-trihydroxybenzoate; Gallic acid n-octyl ester; n-Octyl 3,4,5-trihydroxybenzoate; |
| CAS: | 1034-01-1 |
| EINECS: | 213-853-0 |
| Molecular Formula: | C15H22O5 |
| Molecular Weight: | 282.33 |
| InChI: | InChI=1/C15H22O5/c1-2-3-4-5-6-7-8-20-15(19)11-9-12(16)14(18)13(17)10-11/h9-10,16-18H,2-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.185g/cm3 |
| Refractive index: | 1.552 |
| Appearance: | white granular |
| Specification: |
A white or creamy white powder; Odourless. Practically insoluble in water, very soluble in methanol; Freely soluble in acetone, in ethanol, in ether and in propane-1, 2-diol; Sparingly soluble in arachis and in chloroform. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
