| Identification |
| Name: | 2-Octulosonic acid,3-deoxy-, monoammonium salt (9CI) |
| Synonyms: | 3-Deoxy-2-octulosonic acid monoammonium salt; KDO ammonium salt; |
| CAS: | 103404-70-2 |
| Molecular Formula: | C8H14O8.NH3 |
| Molecular Weight: | 255.22 |
| InChI: | InChI=1/C8H14O8.H3N/c9-2-5(12)7(14)6(13)3(10)1-4(11)8(15)16;/h3,5-7,9-10,12-14H,1-2H2,(H,15,16);1H3 |
| Molecular Structure: |
 |
| Properties |
| Appearance: | white crystalline solid |
| Storage Temperature: | −20°C |
| Usage: | A ketosidic component in all lipopolysaccharides of Gram-negative bacteria and has been identified in several acidic exopolysaccharides (K-antigens). Synthetic analogues of KDO may be studied for their potential to disrupt the biosynthesis of bacter |
| Safety Data |
| |
 |
