| Identification | |
| Name: | Hexanoic acid,2-(diethylamino)ethyl ester |
| Synonyms: | 2-(Diethylamino)ethylcaproate;DA 6;HKL 4; |
| CAS: | 10369-83-2 |
| Molecular Formula: | C12H25NO2 |
| Molecular Weight: | 215.33 |
| InChI: | InChI=1/C12H25NO2/c1-4-7-8-9-12(14)15-11-10-13(5-2)6-3/h4-11H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.907 |
| Refractive index: | 1.444 |
| Appearance: | colorless to yellow transparent liquid |
| Specification: |
?2-Diethylaminoethyl hexanoate , with CAS number of 10369-83-2, can be called Da-6 1.6% as ; da-6(diethyl aminoethyl hexanoate) ; diethyl aminoethyl hexanoate ; 2-diethylaminoethyl hexanoate ; 2-(diethylamino)ethyl caproate ; hexanoic acid 2-(diethylamino)ethyl ester ; hexanoic,2-(diethylamino)ethylestercitrate/diethylamimoethylhexanote . |
| Safety Data | |
 |
|
