| Identification | |
| Name: | 2(1H)-Pyridinone,3-chloro-4-hydroxy- |
| Synonyms: | 2,4-Pyridinediol,3-chloro- (5CI);2,4-Dihydroxy-3-chloropyridine;3-Chloro-2,4-dihydroxypyridine;3-Chloro-4-hydroxy-2(1H)-pyridinone; |
| CAS: | 103792-81-0 |
| EINECS: | 258-441-1 |
| Molecular Formula: | C5H4ClNO2 |
| Molecular Weight: | 145.54 |
| InChI: | InChI=1/C5H4ClNO2/c6-4-3(8)1-2-7-5(4)9/h1-2H,(H2,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.56 |
| Refractive index: | 1.617 |
| Water Solubility: | at 25 deg C (mg/L): 2.846e+005 |
| Solubility: | at 25 deg C (mg/L): 2.846e+005 |
| Specification: |
The 3-Chloro-4-hydroxy-2(1H)-pyridinone, with the CAS registry number 103792-81-0, is also known as 3-Chloro-2,4-dihydroxypyridine. It belongs to the product category of Pyridine. This chemical's molecular formula is C5H4ClNO2 and molecular weight is 145.54. What's more, both its systematic name is called 3-Chloro-2-hydroxypyridin-4(1H)-one. Physical properties about 3-Chloro-4-hydroxy-2(1H)-pyridinone are: (1) ACD/LogP: -1.04; (2) # of Rule of 5 Violations: 0; (3) ACD/BCF (pH 5.5): 1; (4) ACD/BCF (pH 7.4): 1; (5) ACD/KOC (pH 5.5): 1; (6) ACD/KOC (pH 7.4): 1; (7) #H bond acceptors: 3; (8) #H bond donors: 2; (9) #Freely Rotating Bonds: 1; (10) Polar Surface Area: 29.54 Å2; (11) Index of Refraction: 1.617; (12) Molar Refractivity: 32.64 cm3; (13) Molar Volume: 93.2 cm3; (14) Surface Tension: 58.4 dyne/cm; (15) Density: 1.56 g/cm3; (16) Flash Point: 103.6 °C; (17) Enthalpy of Vaporization: 56.34 kJ/mol; (18) Boiling Point: 247.7 °C at 760 mmHg; (19) Vapour Pressure: 0.00412 mmHg at 25 °C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
