Identification |
Name: | L-Cysteine,N-acetyl-S-[(methylamino)carbonyl]- |
Synonyms: | L-Cysteine,N-acetyl-, methylcarbamate (ester) (9CI);N-Acetyl-S-(N-methylcarbamoyl)cysteine |
CAS: | 103974-29-4 |
Molecular Formula: | C7H12 N2 O4 S |
Molecular Weight: | 220.24618 |
InChI: | InChI=1/C7H12N2O4S/c1-4(10)9-5(6(11)12)3-14-7(13)8-2/h5H,3H2,1-2H3,(H,8,13)(H,9,10)(H,11,12) |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.335g/cm3 |
Refractive index: | 1.533 |
Flash Point: | °C |
Usage: | A urinary metabolite of the hepatotoxic experimental antitumour agent N-Methylformamide (NSC 3051) in mouse, rat and man. |
Safety Data |
|
 |