| Identification | |
| Name: | 4-Methoxyphenylacetic acid |
| Synonyms: | p-Methoxyphenylacetic acid; 4-MethoxyPhenylAceticAcid |
| CAS: | 104-01-8 |
| EINECS: | 203-166-4 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1403 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.502 |
| Solubility: | Very soluble |
| Appearance: | white to off-white powder |
| Specification: | white to light yellow crystalline powder and Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
