| Identification | |
| Name: | Benzeneaceticacid, 4-nitro- |
| Synonyms: | Aceticacid, (p-nitrophenyl)- (6CI,8CI);(4-Nitrophenyl)acetic acid;(p-Nitrophenyl)acetic acid;2-(4-Nitrophenyl)acetic acid;2-(p-Nitrophenyl)aceticacid;4-Nitrobenzeneacetic acid;NSC 5398;p-Nitro-a-toluic acid; |
| CAS: | 104-03-0 |
| EINECS: | 203-168-5 |
| Molecular Formula: | C8H7NO4 |
| Molecular Weight: | 181.15 |
| InChI: | InChI=1/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.407 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | pale yellow crystal |
| Specification: | Beige to yellow crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
