| Identification | |
| Name: | Acetamide,N-(4-nitrophenyl)- |
| Synonyms: | N-Acetyl-4-nitroaniline;N-Acetyl-4-nitrobenzenamine;N-Acetyl-p-nitroaniline;NSC 1315;p-Acetamidonitrobenzene;p-Nitroacetanilide;Acetanilide,4'-nitro- (6CI,8CI);Acetanilide, p-nitro- (3CI);1-Nitro-4-acetylaminobenzene;4-(Acetylamino)nitrobenzene;N-(4-Nitrophenyl)acetamide;N-(p-Nitrophenyl)acetamide; |
| CAS: | 104-04-1 |
| EINECS: | 203-169-0 |
| Molecular Formula: | C8H8N2O3 |
| Molecular Weight: | 180.1608 |
| InChI: | InChI=1S/C8H8N2O3/c1-6(11)9-7-2-4-8(5-3-7)10(12)13/h2-5H,1H3,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.34 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.617 |
| Water Solubility: | 2.2 g/l in water |
| Solubility: | 2.2 g/l in water |
| Appearance: | yellow to green-brown crystalline powder |
| Specification: | solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
