| Identification | |
| Name: | p-Chlorophenyl isocyanate |
| Synonyms: | Isocyanicacid, p-chlorophenyl ester (6CI,7CI,8CI); 1-Chloro-4-isocyanatobenzene;1-Isocyanato-4-chlorobenzene; 4-Chloro-1-isocyanatobenzene;4-Chloroisocyanatobenzene; 4-Chlorophenyl isocyanate; NSC 76589; p-Chlorophenylisocyanate |
| CAS: | 104-12-1 |
| EINECS: | 203-176-9 |
| Molecular Formula: | C7H4 Cl N O |
| Molecular Weight: | 153.57 |
| InChI: | InChI=1/C7H4ClNO/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2206 |
| Density: | 1.26 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5618 |
| Water Solubility: | DECOMPOSES |
| Solubility: | DECOMPOSES |
| Appearance: | colorless to light yellow liquid |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Color: | WHITE SOLID |
| Usage: | Chemical intermediate for herbicides- difluron, buturon, & monolinuron. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
