| Identification | |
| Name: | 4-butylaniline |
| Synonyms: | Butylaniline,98%; L-1,2,3-Tetrahhydroisoquinoline-3-Carboxylic Acid; 4-n-Butylaniline |
| CAS: | 104-13-2 |
| EINECS: | 203-177-4 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2738/2810 |
| Flash Point: | 215? |
| Density: | 0.932 |
| Stability: | No data. |
| Refractive index: | 1.5341 |
| Solubility: | Insoluble |
| Appearance: | Clear colorless mobile liquid with a ethereal odor. |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29214980 |
| Flash Point: | 215? |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
