| Identification | |
| Name: | 1-Piperazineethanamine,N,N,4-trimethyl- |
| Synonyms: | Piperazine,1-[2-(dimethylamino)ethyl]-4-methyl- (6CI,7CI,8CI);1-[2-(Dimethylamino)ethyl]-4-methylpiperazine; KL 8; Kaolizer 8;N,N,N'-Trimethylaminoethylpiperazine;N-Methyl-N'-(N,N-dimethylaminoethyl)piperazine;N-Methyl-N'-(dimethylaminoethyl)piperazine; N-Methyl-N'-(b-dimethylaminoethyl)piperazine;NSC 79879; S 36081-3; Toyocat NP |
| CAS: | 104-19-8 |
| EINECS: | 203-183-7 |
| Molecular Formula: | C9H21 N3 |
| Molecular Weight: | 171.33 |
| InChI: | InChI=1/C9H21N3/c1-10(2)4-7-12-8-5-11(3)6-9-12/h4-9H2,1-3H3 |
| Molecular Structure: | ![(C9H21N3) Piperazine,1-[2-(dimethylamino)ethyl]-4-methyl- (6CI,7CI,8CI);1-[2-(Dimethylamino)ethyl]-4-methylpip...](https://img1.guidechem.com/chem/e/dict/26/104-19-8.jpg) |
| Properties | |
| Transport: | 2922 |
| Density: | 0,89 g/cm3 |
| Refractive index: | 1.476 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Safety Data | |
 |
|
