| Identification | |
| Name: | Benzenemethanol,4-methoxy-, 1-acetate |
| Synonyms: | Benzenemethanol,4-methoxy-, acetate (9CI);Benzyl alcohol, p-methoxy-, acetate (7CI,8CI);p-Anisyl alcohol, acetate (6CI);1-Methoxy-4-acetoxymethylbenzene;4-Anisylacetate;4-Methoxybenzenemethanol acetate;4-Methoxybenzyl acetate;Cassieketone;NSC 46102;p-Methoxybenzyl acetate;p-Methoxybenzyl alcohol acetate; |
| CAS: | 104-21-2 |
| EINECS: | 203-185-8 |
| Molecular Formula: | C10H12O3 |
| Molecular Weight: | 180.2 |
| InChI: | InChI=1/C10H12O3/c1-8(11)13-7-9-3-5-10(12-2)6-4-9/h3-6H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 84 |
| Density: | 1.1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.512-1.514 |
| Water Solubility: | insoluble in water, glycerol, propylene glycol; soluble in organic solvents, oils |
| Solubility: | insoluble in water, glycerol, propylene glycol; soluble in organic solvents, oils |
| Appearance: | colourless to pale yellow liquid with a floral, fruity, balsamic odour |
| Specification: |
Anisyl acetate ,its CAS NO. is 104-21-2,the synonyms is 4-Methoxybenzenemethanol, acetate ; 4-Methoxybenzenenemethyl acetate ; 4-Methoxybenzyl acetate ; AI3-04097 ; Anisyl acetate (natural) ; Anisyl acetate, p-isomer ; Benzenemethanol, 4-methoxy-, acetate ; Benzyl alcohol, p-methoxy-, acetate ; Cassie ketone ; EINECS 203-185-8 ; FEMA No. 2098 ; Methoxybenzyl acetate, p- ; NSC 46102 ; UNII-2GEC7KBO31 ; p-Methoxybenzyl alcohol acetate. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
