| Identification | |
| Name: | Benzoyl chloride,4-(2-phenyldiazenyl)- |
| Synonyms: | Benzoylchloride, 4-(phenylazo)- (9CI);Benzoyl chloride, p-(phenylazo)- (6CI,7CI,8CI);4-(Chlorocarbonyl)azobenzene;4-Phenylazobenzoyl chloride;NSC 7955;p-(Phenylazo)benzoyl chloride;4-phenyldiazenyl-benzoyl chloride; |
| CAS: | 104-24-5 |
| EINECS: | 203-188-4 |
| Molecular Formula: | C13H9ClN2O |
| Molecular Weight: | 244.68 |
| InChI: | InChI=1/C13H9ClN2O/c14-13(17)10-6-8-12(9-7-10)16-15-11-4-2-1-3-5-11/h1-9H/b16-15+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 94-97 °C(lit.) |
| Flash Point: | 148.2°C |
| Boiling Point: | 382.6°Cat760mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.602 |
| Appearance: | orange-red crystalline powder |
| Specification: | ORANGE-RED CRYSTALLINE POWDER Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 148.2°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
