Identification |
Name: | 2-Propenoic acid,3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
Synonyms: | Cinnamicacid, p-methoxy-, 2-ethoxyethyl ester (6CI,7CI,8CI);Ethanol, 2-ethoxy-,p-methoxycinnamate (8CI);2-Ethoxyethyl 4-methoxycinnamate;2-Ethoxyethylp-methoxycinnamate;Cinoxate;Giv Tan F;Give-Tan;Phiasol;Sundare;p-Methoxycinnamic acid 2-ethoxyethyl ester; |
CAS: | 104-28-9 |
EINECS: | 203-191-0 |
Molecular Formula: | C14H18 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | Solidifies below -25 deg C |
Flash Point: | 164.8°C |
Boiling Point: | 374.6°Cat760mmHg |
Density: | 1.086g/cm3 |
Refractive index: | 1.527 |
Solubility: | Soluble in glycerol 0.5%, propolyene glycol 5%. Miscible with alcohols and vegetable oils. Practically insoluble in water 0.05%. |
Flash Point: | 164.8°C |
Color: | Viscous liquid, may have slight yellow tinge |
Safety Data |
|
 |