| Identification | |
| Name: | Ethanol,2-(4-nonylphenoxy)- |
| Synonyms: | Ethanol,2-(p-nonylphenoxy)- (7CI,8CI); 2-(4-Nonylphenoxy)ethyl alcohol;2-(p-Nonylphenoxy)ethanol; Ethylene glycol mono-p-nonylphenyl ether; Ethyleneglycol p-nonylphenyl ether |
| CAS: | 104-35-8 |
| Molecular Formula: | C17H28 O2 |
| Molecular Weight: | 264.40302 |
| InChI: | InChI=1/C17H28O2/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)19-15-14-18/h10-13,18H,2-9,14-15H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.6°C |
| Boiling Point: | 385.2°Cat760mmHg |
| Density: | 0.958g/cm3 |
| Refractive index: | 1.499 |
| Solubility: | Lower adducts (n<6): soluble in oil; higher adducts: soluble in water |
| Specification: | Brown Low Melting Solid usageEng:Used as analytical standard for environmental analysis. ISO/CD 18857-2 (International Organization for Standardization, Geneva) describes a new international standard method for the determination of octylphenol, nonylphenol, their mono- and diethyoxylates |
| Flash Point: | 155.6°C |
| Storage Temperature: | Refrigerator |
| Color: | Lower adducts (n20) pale yellow to off-white pastes or waxes |
| Usage: | Used as analytical standard for environmental analysis. ISO/CD 18857-2 (International Organization for Standardization, Geneva) describes a new international standard method for the determination of octylphenol, nonylphenol, their mono- and diethyoxylates |
| Safety Data | |
 |
|
