| Identification | |
| Name: | 4-n-Nonylphenol |
| Synonyms: | 1-(4-Hydroxyphenyl)nonane |
| CAS: | 104-40-5 |
| EINECS: | 203-199-4 |
| Molecular Formula: | C15H24O |
| Molecular Weight: | 220.35 |
| InChI: | InChI=1/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3145 8 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.511(lit.) |
| Solubility: | Water solubility = 7 mg/L at 25 deg C |
| Appearance: | viscous colourless liquid with a phenol-like smell |
| Specification: | viscous colourless liquid with a phenol-like smell usageEng:Used in the process for the manufacture of 5-nonyl salicylaldoxime, which is used for the selective purification and concentration of copper ions. Safety Statements:26-36/37/39-45-61-60 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 60:This material and/or its container must be disposed of as hazardous waste |
| Packinggroup: | III |
| Storage Temperature: | APPROX 20°C |
| Color: | Pale yellow viscous liquid /Nonylphenol/ |
| Usage: | Used in the process for the manufacture of 5-nonyl salicylaldoxime, which is used for the selective purification and concentration of copper ions. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
