| Identification | |
| Name: | p-methoxy phenylacetonitrile |
| Synonyms: | p-Anisyl cyanide; p-Methoxybenzyl cyanide; Benzeneacetonitrile, 4-methoxy-; 4-Methoxyphenylacetonitrile; 4-Methoxybenzyl cyanide |
| CAS: | 104-47-2 |
| EINECS: | 203-206-0 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.18 |
| InChI: | InChI=1/C9H9NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 6.1/PG 3 |
| Density: | 1.08 |
| Stability: | No data. |
| Refractive index: | 1.53 |
| Solubility: | Slightly soluble |
| Appearance: | Clear colorless to slightly yellow liquid |
| Specification: |
?4-Methoxybenzyl cyanide , its cas register number is 104-47-2. It also can be called p-Methoxy phenylacetonitrile ; 4-Methoxyphenylacetonitrile ; and p-Methoxybenzyl cyanide . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
