| Identification | |
| Name: | 2(3H)-Furanone,5-butyldihydro- |
| Synonyms: | octan-4-olide; Octano-1,4-lactone; g-Octalactone; 4-Hydroxyoctanoic acid gamma-lactone; 3,7-Dimethyl-1,6-octadien-3-ol; 4-n-Butyl-4-hydroxybutyric acid lactone; Octanolide-1,4; Gamma-Octalactone |
| CAS: | 104-50-7 |
| EINECS: | 203-208-1 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-2-3-4-7-5-6-8(9)10-7/h7H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.981 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.443-1.445 |
| Solubility: | Slightly soluble |
| Appearance: | clear, colorless liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
