| Identification | |
| Name: | 2(3H)-Furanone,5-heptyldihydro- |
| Synonyms: | Undecanoicacid, 4-hydroxy-, g-lactone(6CI,7CI);4-Hydroxyundecanoic acid lactone;4-Undecanolide;5-Heptyldihydro-2(3H)-furanone;5-Heptyltetrahydro-2-furanone;NSC 406421;NSC46118;NSC 76413;Neutralizing agent 350120-1;Peach lactone;Peche Pure;Persicol;g-(n-Heptyl)-g-butyrolactone;g-Heptyl-g-butyrolactone;g-Heptylbutyrolactone;g-Undecalactone;g-Undecanolactone;g-Undecanolide;g-n-Heptylbutyrolactone; |
| CAS: | 104-67-6 |
| EINECS: | 203-225-4 |
| Molecular Formula: | C11H20 O2 |
| Molecular Weight: | 184.31 |
| InChI: | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137 oC |
| Boiling Point: | 164-166 oC (13 torr) |
| Density: | 0.9425 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.449-1.454 |
| Appearance: | Colourless oily liquid |
| Specification: | clear colourless liquid Safety Statements:26-36-37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 137 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
