Identification |
Name: | 2(3H)-Furanone,5-heptyldihydro- |
Synonyms: | Undecanoicacid, 4-hydroxy-, g-lactone(6CI,7CI);4-Hydroxyundecanoic acid lactone;4-Undecanolide;5-Heptyldihydro-2(3H)-furanone;5-Heptyltetrahydro-2-furanone;NSC 406421;NSC46118;NSC 76413;Neutralizing agent 350120-1;Peach lactone;Peche Pure;Persicol;g-(n-Heptyl)-g-butyrolactone;g-Heptyl-g-butyrolactone;g-Heptylbutyrolactone;g-Undecalactone;g-Undecanolactone;g-Undecanolide;g-n-Heptylbutyrolactone; |
CAS: | 104-67-6 |
EINECS: | 203-225-4 |
Molecular Formula: | C11H20 O2 |
Molecular Weight: | 184.31 |
InChI: | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 137 oC |
Boiling Point: | 164-166 oC (13 torr) |
Density: | 0.9425 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.449-1.454 |
Appearance: | Colourless oily liquid |
Specification: | clear colourless liquid Safety Statements:26-36-37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection 36/37:Wear suitable protective clothing and gloves |
Flash Point: | 137 oC |
Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |