| Identification | |
| Name: | 2-ethyl-hexylamine |
| Synonyms: | Isooctyl amine; 1-amino-2-ethylhexane; 1-Hexanamine, 2-ethyl-; 2-ethylhexylamine; TIMTEC-BB SBB006745; 1-Amino-2-ethylhexan; 2-ethvlhexvlamine; 2-ethyl-1-hexanamin; 2-Ethylhexanamine; 2-ethyl-hexylamin; 3-Octylamine; Armeen L8D |
| CAS: | 104-75-6 |
| EINECS: | 203-233-8 |
| Molecular Formula: | C8H19N |
| Molecular Weight: | 129.24 |
| InChI: | InChI=1/C8H19N/c1-3-5-6-8(4-2)7-9/h8H,3-7,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2276 |
| Density: | 0.7894 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4295-1.4315 |
| Solubility: | 2.5 g/L (20 oC) |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:26-36/37/39-45-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29211980 |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Usage: | Used to make pharmaceuticals and other chemicals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
