| Identification | |
| Name: | 2-Ethyl-1-hexanol |
| Synonyms: | Isooctanol; 2-Ethylhexan-1-ol; 2-Ethylhexanol; 2-ethyl hexanol |
| CAS: | 104-76-7 |
| EINECS: | 203-234-3 |
| Molecular Formula: | C8H18O |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.833 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.43-1.433 |
| Solubility: | Water Solubility :1 g/L (20 oC) |
| Appearance: | colourless liquid |
| Specification: |
?2-Ethylhexanol (CAS NO.104-76-7), its Synonyms are 1-Hexanol, 2-ethyl- ; 2-Aethylhexanol ; 2-Ethylhexyl alcohol ; Octyl alcohol . |
| Packinggroup: | I; II; III |
| HS Code: | 29051610 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | COLORLESS LIQUID |
| Usage: | Mercerizing textiles, as solvent for dyes, resins, oils, also claimed to possess antifoaming properties. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
