| Identification | |
| Name: | 3-Diethylaminopropylamine |
| Synonyms: | N,N-Diethyl-1,3-propanediamine; (3-Diethylamino)propylamine; 3-aminopropyldiethylamine; N,N-Diethyl-1,3-Propyldiamine; N,N-Diethyl-1,3-diaminopropane; 3-dietgylpropanediamine; DEAPA; N,N-Diethyl-1,3-propane diamine; 1-(Diethylamino)propylamine-3; 1,3-Propanediamine,N,N-diethyl-; 3-(N,N-Diethylamino)-1-propylamine; 3-Propanediamine,N,N-diethyl-1; Diethylaminotrimethylenamine; gamma-(Diethylamino)propylamine; N-(3-Diethylaminopropyl)amine; N,N-(Diethylamino)propylamine |
| CAS: | 104-78-9 |
| EINECS: | 203-236-4 |
| Molecular Formula: | C7H18N2 |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1/C7H18N2/c1-3-9(4-2)7-5-6-8/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2684 |
| Density: | 0.82 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4406-1.4426 |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible AUTOIGNITION |
| Appearance: | clear liquid |
| Specification: | clear colorless to slightly yellowish liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29212900 |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Usage: | Used to make other chemicals and as a component of adhesives. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
