| Identification | |
| Name: | 1,2-Ethanediamine,N1,N1-diethyl-N2-methyl- |
| Synonyms: | 1,2-Ethanediamine,N,N-diethyl-N'-methyl- (9CI); Ethylenediamine, N,N-diethyl-N'-methyl-(6CI,8CI); 2-(Diethylamino)-N-methylethylamine;Diethyl(2-methylaminoethyl)amine; Methyl(2-(diethylamino)ethyl)amine;N,N-Diethyl-N'-methyl-1,2-ethanediamine; N,N-Diethyl-N'-methylethylenediamine;N-[2-(Diethylamino)ethyl]-N-methylamine; NSC 27480;[2-(Diethylamino)ethyl]methylamine |
| CAS: | 104-79-0 |
| EINECS: | 203-238-5 |
| Molecular Formula: | C7H18 N2 |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1/C7H18N2/c1-4-9(5-2)7-6-8-3/h8H,4-7H2,1-3H3/p+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 8/PG 2 |
| Flash Point: | 41.1°C |
| Boiling Point: | 153.6°Cat760mmHg |
| Density: | 0.813g/cm3 |
| Refractive index: | n20/D 1.4296(lit.) |
| Specification: | CLEAR COLORLESS LIQUID Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 41.1°C |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
