| Identification | |
| Name: | 4-Methyl benzyl chloride |
| Synonyms: | p-Xylyl chloride; alpha-Chloro-p-xylene; Benzene, 1-(chloromethyl)-4-methyl-; 4-Methylbenzyl Chloride; p-chloromethyltoluene |
| CAS: | 104-82-5 |
| EINECS: | 203-241-1 |
| Molecular Formula: | C8H9Cl |
| Molecular Weight: | 140.61 |
| InChI: | InChI=1/C8H9Cl/c1-7-2-4-8(6-9)5-3-7/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 |
| Density: | 1.062 |
| Stability: | Stable under normal temperatures and pressures. Fuming liquid. |
| Refractive index: | 1.533-1.535 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless to light yellow liquid with an irritating odor. |
| Specification: | clear colourless to light yellow liquid Safety Statements:26-27-36/37/39-45-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Refrigerator (approx 4 C). |
| Sensitive: | Lachrymatory |
| Color: | LIQUID |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
