| Identification | |
| Name: | 4-Chlorobenzylamine |
| Synonyms: | Benzylamine, p-chloro- (8CI);Benzenemethanamine, 4-chloro-;(4-chlorophenyl)methanamine;(4-chlorophenyl)methylazanium;Benzylamine, p-chloro-;p-Chlorobenzylamine;p-Chlorobenzyl amine; |
| CAS: | 104-86-9 |
| EINECS: | 203-245-3 |
| Molecular Formula: | C7H8ClN |
| Molecular Weight: | 141.6 |
| InChI: | InChI=1/C7H8ClN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Density: | 1.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5576-1.5596 |
| Solubility: | Very soluble |
| Appearance: | Clear almost colorless liquid. |
| Specification: | clear slightly yellow liquid Safety Statements:26-36-45-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Do not expose to air. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
