| Identification |
| Name: | 4-Bromoanisole |
| CAS: | 104-92-7 |
| EINECS: | 203-252-1 |
| Molecular Formula: | C7H7BrO |
| Molecular Weight: | 187.03 |
| InChI: | InChI=1/C7H7BrO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 61699? |
| Density: | 1.494 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.563-1.565 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | clear to slightly yellow liquid |
| Packinggroup: | O53 |
| HS Code: | 29093038 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
