| Identification | |
| Name: | 4-Methylanisole |
| Synonyms: | 1-Methoxy-4-methylbenzene; MSO; p-Cresyl methyl ether; METHYL-P-CRESOL; METHYL P-TOLYL ETHER; FEMA 2681; 4-METHOXYTOLUENE; p-Methylanisole |
| CAS: | 104-93-8 |
| EINECS: | 203-253-7 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-7-3-5-8(9-2)6-4-7/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Melting Point: | -32°C |
| Density: | 0.96 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.51-1.513 |
| Water Solubility: | slightly soluble |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | clear to slightly yellow liquid |
| Specification: | colourless liquid Safety Statements:36/37-16 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Usage: | Synthetic flavor. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
