| Identification | |
| Name: | Benzene,1-bromo-4-(methylthio)- |
| Synonyms: | Sulfide,p-bromophenyl methyl (6CI,7CI,8CI);1-Bromo-4-(methylsulfanyl)benzene;1-Bromo-4-(methylthio)benzene;4-(Methylthio)bromobenzene;4-Bromo-1-(methylthio)benzene;4-Bromophenyl methyl sulfide;4-Methylthiophenyl bromide;Methyl 4-bromophenyl sulfide;Methyl p-bromophenyl sulfide;NSC 73383;p-(Methylthio)phenyl bromide;p-Bromo(methylthio)benzene;p-Bromophenyl methyl sulfide;p-Bromothioanisole; |
| CAS: | 104-95-0 |
| EINECS: | 203-255-8 |
| Molecular Formula: | C7H7BrS |
| Molecular Weight: | 203.1 |
| InChI: | InChI=1/C7H7BrS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 103 |
| Refractive index: | 1.624 |
| Appearance: | slightly brown solid. |
| Specification: | white to beige low melting crystalline mass, Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
