| Identification | |
| Name: | 4-Amino thioanisole |
| Synonyms: | 4-Methylmercaptoaniline |
| CAS: | 104-96-1 |
| EINECS: | 203-256-3 |
| Molecular Formula: | C7H9NS |
| Molecular Weight: | 139.22 |
| InChI: | InChI=1/C7H9NS/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 156 - 158 |
| Flash Point: | >230 ºF |
| Density: | 1.119 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.638-1.64 |
| Solubility: | Slightly soluble |
| Appearance: | Brown - pale-yellow liquid. With a stench. |
| Specification: | clear orange to brown-red liquid Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | >230 ºF |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
