Identification |
Name: | Benzoic acid,4-methoxy-, carboxymethyl ester |
Synonyms: | p-Anisicacid, ester with glycolic acid (7CI,8CI); Glycolic acid, p-anisate (8CI);(4-Methoxybenzoyloxy)acetic acid; NSC 226840 |
CAS: | 10414-68-3 |
EINECS: | 600-527-1 |
Molecular Formula: | C10H10 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C10H10O5/c1-14-8-4-2-7(3-5-8)10(13)15-6-9(11)12/h2-5H,6H2,1H3,(H,11,12) |
Molecular Structure: |
![(C10H10O5) p-Anisicacid, ester with glycolic acid (7CI,8CI); Glycolic acid, p-anisate (8CI);(4-Methoxybenzoylox...](https://img1.guidechem.com/chem/e/dict/51/10414-68-3.jpg) |
Properties |
Flash Point: | 165.8°C |
Boiling Point: | 410.3°Cat760mmHg |
Density: | 1.293g/cm3 |
Refractive index: | 1.539 |
Flash Point: | 165.8°C |
Safety Data |
|
![](/images/detail_15.png) |