Identification |
Name: | 1-Piperidinehexanoicacid, 3,4,5-trihydroxy-2-(hydroxymethyl)-, [2R-(2a,3b,4a,5a)]- (9CI) |
Synonyms: | N-5-Carboxypentyl-1-deoxymannojirimycin |
CAS: | 104154-10-1 |
Molecular Formula: | C12H23 N O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H23NO6/c14-7-8-11(18)12(19)9(15)6-13(8)5-3-1-2-4-10(16)17/h8-9,11-12,14-15,18-19H,1-7H2,(H,16,17)/t8?,9-,11+,12?/m0/s1 |
Molecular Structure: |
 |
Properties |
Refractive index: | 1.567 |
Usage: | Ligand used for the preparation of an affinity resin specific for Man9 mannosidase, an enzyme involved in the post-translational processing of N-linked glycoprotein (Man)9(GlcNAc)2. |
Safety Data |
|
 |