| Identification |
| Name: | 5,8,11,14,17-Eicosapentaenoicacid, (5Z,8Z,11Z,14Z,17Z)- |
| Synonyms: | 5,8,11,14,17-Eicosapentaenoicacid (6CI);5,8,11,14,17-Eicosapentaenoic acid, (all-Z)- (8CI);(5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoicacid;(all-Z)-5,8,11,14,17-Eicosapentaenoic acid;(all-cis)-5,8,11,14,17-Eicosapentaenoic acid;EPA;Eicosapentaenoic acid;Icosapent;Icosapentaenoic acid;Ropufa 70;Timnodonic acid; |
| CAS: | 10417-94-4 |
| Molecular Formula: | C20H30O2 |
| Molecular Weight: | 302.45 |
| InChI: | InChI=1/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 0.941 g/cm3 |
| Refractive index: | n20/D 1.4977(lit.) |
| Appearance: | Liquid |
| Usage: | Important polyunsaturated fatty acid of the marine food chain that serves as a precursor for the prostaglandin-3 and thromboxane-3 families. It differs from arachidonic acid (the eicosatetraenoic acid that is a precursor for the prostaglandin and th |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |
