| Identification | |
| Name: | Famciclovir |
| Synonyms: | Amciclovir;BRL 42810;[2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate;FCV;1,3-Propanediol, 2-(2-(2-amino-9H-purin-9-yl)ethyl)-, diacetate (ester);2-(2-(2-Amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate (ester);Diacetyl 6-deoxy-9-(4-hydroxy-3-hydroxymethyl-but-1-yl)guanine;Famvir;1,3-Propanediol,2-[2-(2-amino-9H-purin-9- yl)ethyl]-,diacetate (ester);Butenafine Hydrochloride;Famcyclovir; |
| CAS: | 104227-87-4 |
| Molecular Formula: | C14H19N5O4 |
| Molecular Weight: | 321.33 |
| InChI: | InChI=1/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| Molecular Structure: | ![(C14H19N5O4) Amciclovir;BRL 42810;[2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate;FCV;1,3-Propanediol, 2...](https://img.guidechem.com/casimg/104227-87-4.gif) |
| Properties | |
| Density: | 1.4g/cm3 |
| Refractive index: | 1.628 |
| Solubility: | Insoluble |
| Appearance: | off-white powder |
| Specification: |
?Famciclovir , its CAS NO. is 104227-87-4, the synonyms are 2-(2-(2-Amino-9H-purin-9-yl)ethyl)-1,3-propanediol |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | Used as an antiviral. Prodrug of penciclovir |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
