Identification |
Name: | 1H-Isoindole-1,3(2H)-dione,2-(3-azetidinyl)- |
Synonyms: | 3-PHTHALIMIDOAZETIDINE;2-(3-Azetidinyl)-1H-isoindol-1,3(2H)-dione |
CAS: | 104390-83-2 |
Molecular Formula: | C11H10 N2 O2 |
Molecular Weight: | 202.2093 |
InChI: | InChI=1/C11H10N2O2/c14-10-8-3-1-2-4-9(8)11(15)13(10)7-5-12-6-7/h1-4,7,12H,5-6H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 165.5°C |
Boiling Point: | 350.1°C at 760 mmHg |
Density: | 1.411g/cm3 |
Refractive index: | 1.659 |
Flash Point: | 165.5°C |
Usage: | A useful intermediate in the synthesis of polypeptides |
Safety Data |
|
 |