| Identification | |
| Name: | 2H-1-Benzopyran-2-one,3-acetyl-7-hydroxy- |
| Synonyms: | Coumarin,3-acetyl-7-hydroxy- (7CI,8CI);Umbelliferone, 3-acetyl- (6CI);3-Acetyl-7-hydroxychromen-2-one;3-Acetyl-7-hydroxycoumarin;3-Acetylumbelliferone;7-Hydroxy-3-acetylcoumarin; |
| CAS: | 10441-27-7 |
| Molecular Formula: | C11H8O4 |
| Molecular Weight: | 204.18 |
| InChI: | InChI=1/C11H8O4/c1-6(12)9-4-7-2-3-8(13)5-10(7)15-11(9)14/h2-5,13H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 195.2°C |
| Boiling Point: | 473.1°C at 760 mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.619 |
| Water Solubility: | DMF: soluble |
| Solubility: | DMF: soluble |
| Specification: | usageEng:These lipoid indicators are also probes for phase transitions in lipid membranes and may register the detailed chemical structure of the polar head-group region or the packing density in lamellar lipid layers. |
| Flash Point: | 195.2°C |
| Usage: | These lipoid indicators are also probes for phase transitions in lipid membranes and may register the detailed chemical structure of the polar head-group region or the packing density in lamellar lipid layers. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
