| Identification | |
| Name: | Phenethyl caffeate |
| Synonyms: | 2-Phenylethylcaffeate;2-Propenoic acid,3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester;2-Phenylethyl 3-(3,4-dihydroxyphenyl)-2-propenoate; |
| CAS: | 104594-70-9 |
| Molecular Formula: | C17H16O4 |
| Molecular Weight: | 284.33 |
| InChI: | InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.266 g/cm3 |
| Appearance: | Colorless transparent liquid |
| Specification: |
Caffeic acid phenethyl ester (CAS NO.104594-70-9) also can be called Phenethyl caffeate ; CAPE compound ; 2-propenoic acid, 3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester, (2E)- ; 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester, (E)- ; 2-Phenylethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate . |
| Biological Activity: | Antioxidant, antimitogenic, anticarcinogenic, anti-inflammatory and antiviral. Specifically inhibits NF- κ B activation and inhibits the growth of transformed cells. Also suppresses lipid peroxidation and inhibits ornithine decarboxylase, protein tyrosine kinase and lipoxygenase activities. |
| Usage: |
Caffeic acid phenethyl ester (CAS NO.104594-70-9) can be used for cytotoxic agent against cancer cell lines ,inhibitor of ornithine decarboxylase and protein tyrosine kinase. It has been found to be a specific inhibitor of the nuclear transcription factor, NF-kB, And also been shown to significantly suppress the lipoxyg. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
