| Identification | |
| Name: | Benzeneacetic acid,4-hydroxy-3-nitro- |
| Synonyms: | Aceticacid, (4-hydroxy-3-nitrophenyl)- (7CI,8CI);4-Hydroxy-3-nitrobenzeneaceticacid;4-Hydroxy-3-nitrophenylacetic acid;4-Hydroxy-5-nitrophenylacetic acid;Antibiotic T 0007B1;Antibiotic T 000B1;m-Nitro-p-hydroxyphenylacetic acid; |
| CAS: | 10463-20-4 |
| EINECS: | 233-948-0 |
| Molecular Formula: | C8H7NO5 |
| Molecular Weight: | 197.1449 |
| InChI: | InChI=1S/C8H7NO5/c10-7-2-1-5(4-8(11)12)3-6(7)9(13)14/h1-3,10H,4H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.435 g/cm3 |
| Water Solubility: | soluble in DMSO, DMF and basic H2O |
| Solubility: | soluble in DMSO, DMF and basic H2O |
| Appearance: | yellow crystalline powder |
| Specification: | yellow crystalline powder usageEng:A metabolite of Nitrotyrosine (N597000), which is excreted in the urine. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | −20°C |
| Color: | yellow |
| Usage: | A metabolite of Nitrotyrosine (N597000), which is excreted in the urine. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
