| Identification | |
| Name: | 3H-1,4-Benzodiazepin-2-amine,7-chloro-N-methyl-5-phenyl-, 4-oxide, nitroso derivs. |
| Synonyms: | Chlordiazepoxide, nitrosated;Chlordiazepoxide mixed with sodium nitrite (1:1);Sodium nitrite mixed with chlordiazepoxide (1:1);3H-1,4-Benzodiazepine, 7-chloro-2-methylamino-5-phenyl-, 4-oxide, mixed with sodium nitrite(1:1);104639-49-8;LS-34066 |
| CAS: | 104639-49-8 |
| Molecular Formula: | C16H14ClN4NaO3 |
| Molecular Weight: | 368.7501 |
| InChI: | InChI=1/C16H14ClN3O.HNO2.Na/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15;2-1-3;/h2-9,21H,10H2,1H3;(H,2,3);/q;;+1/p-1/b18-15-;; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 226.6°C |
| Boiling Point: | 451°C at 760 mmHg |
| Specification: |
The extinguishing agent of Sodium nitrite mixed with chlordiazepoxide (1:1) (CAS No. 104639-49-8) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 226.6°C |
| Safety Data | |
 |
|
