| Identification | |
| Name: | Phenol,4,4'-[(1R,2S)-1,2-diethyl-1,2-ethanediyl]bis[2-methyl-, rel- |
| Synonyms: | Phenol,4,4'-(1,2-diethyl-1,2-ethanediyl)bis[2-methyl-, (R*,S*)- (9CI); o-Cresol,4,4'-(1,2-diethylethylene)di-, meso- (8CI) |
| CAS: | 10465-10-8 |
| Molecular Formula: | C20H26 O2 |
| Molecular Weight: | 298.46 |
| InChI: | InChI=1/C20H26O2/c1-5-17(15-7-9-19(21)13(3)11-15)18(6-2)16-8-10-20(22)14(4)12-16/h7-12,17-18,21-22H,5-6H2,1-4H3/t17-,18+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.9°C |
| Boiling Point: | 418.9°C at 760 mmHg |
| Density: | 1.066g/cm3 |
| Refractive index: | 1.573 |
| Specification: |
4,4′-(1,2-Diethylethylene)di-o-cresol ,with CAS number of 10465-10-8,can be called o-Cresol, 4,4'-(1,2-diethylethylene)di- ; meso-3,4-Bis(4-hydroxy-3-methylphenyl)hexane ; o-Cresol, 4,4'-(1,2-diethylethylene)di- ; 3-06-00-05541 (Beilstein Handbook Reference) [Beilstein] . |
| Flash Point: | 185.9°C |
| Safety Data | |
 |
|
