| Identification | |
| Name: | 4,4'-(1-methylene) bis-Benzonitrile |
| Synonyms: | 4,4'-(1-Methylene) |
| CAS: | 10466-37-2 |
| Molecular Formula: | C15H10N2 |
| Molecular Weight: | 218.25 |
| InChI: | InChI=1/C15H10N2/c16-10-14-5-1-12(2-6-14)9-13-3-7-15(11-17)8-4-13/h1-8H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.617 |
| Appearance: | White solid |
| Specification: |
The 4,4'-Dicyanodiphenylmethane with the CAS number 10466-37-2 is also called Benzonitrile,4,4'-methylenebis-. The IUPAC name is 4-[(4-cyanophenyl)methyl]benzonitrile. Its molecular formula is C15H10N2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 3.08; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 47.58 Å2; (7)Index of Refraction: 1.617; (8)Molar Refractivity: 65.22 cm3; (9)Molar Volume: 186.3 cm3; (10)Polarizability: 25.85×10-24cm3; (11)Surface Tension: 57.3 dyne/cm; (12)Enthalpy of Vaporization: 66.29 kJ/mol; (13)Vapour Pressure: 5.96×10-7 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
