Identification |
Name: | Benzene,2-methoxy-1-(pentyloxy)-4-(1-propen-1-yl)- |
Synonyms: | Benzene,2-methoxy-1-(pentyloxy)-4-(1-propenyl)- (9CI); Benzene,2-methoxy-1-(pentyloxy)-4-propenyl- (8CI); 2-Pentyloxy-5-prop-1-enylanisole;Amyloxyisoeugenol |
CAS: | 10484-36-3 |
EINECS: | 233-996-2 |
Molecular Formula: | C15H22 O2 |
Molecular Weight: | 234.37 |
InChI: | InChI=1/C15H22O2/c1-4-6-7-11-17-14-10-9-13(8-5-2)12-15(14)16-3/h5,8-10,12H,4,6-7,11H2,1-3H3/b8-5+ |
Molecular Structure: |
|
Properties |
Flash Point: | 122.9°C |
Boiling Point: | 336.6°Cat760mmHg |
Density: | 0.958g/cm3 |
Refractive index: | 1.517 |
Specification: |
Amyl isoeugenol , its cas register number is 10484-36-3. It also can be called Amyl isoeugenol ether ; Amyloxyisoeugenol ; and 2-Methoxy-1-(pentyloxy)-4-(1-propenyl)-benzene .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 122.9°C |
Safety Data |
|
|