| Identification | |
| Name: | 2-Butenoyl chloride |
| Synonyms: | Crotonoylchloride (6CI,7CI,8CI);Crotonic acid chloride;b-Methylacryloyl chloride; |
| CAS: | 10487-71-5 |
| EINECS: | 234-010-3 |
| Molecular Formula: | C4H5ClO |
| Molecular Weight: | 104.53 |
| InChI: | InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.09 |
| Refractive index: | 1.459 |
| Water Solubility: | Decomposes in water |
| Solubility: | Decomposes in water |
| Appearance: | clear to light yellow liquid |
| Specification: |
The chemical synonyms of (E)-But-2-enoyl chloride (CAS NO.10487-71-5) are 2-Butenoyl chloride ; 2-Butenoylchloride ; But-2-enoylchloride ; Trans-2-butenoyl chloride ; Crotonyl chloride ; Crotonoyl chloride ; Crotonic acid chloride ; E-crotonyl chloride . |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
