| Identification | |
| Name: | Benzene, 1,4-diethyl- |
| Synonyms: | Benzene,p-diethyl- (8CI);p-Xylene, a,a'-dimethyl- (7CI);p-Diethylbenzene;p-Ethylethylbenzene; |
| CAS: | 105-05-5 |
| EINECS: | 203-265-2 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.22 |
| InChI: | InChI=1/C10H14/c1-3-9-5-7-10(4-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2049 3 |
| Density: | 0.86 |
| Refractive index: | n20/D 1.495(lit.) |
| Solubility: | Miscible in ethanol, ethyl ether and acetone Soluble in alcohol, benzene, carbon tetrachloride, ether. /Diethylbenzene/ In water, 24.8 mg/l @ 25 deg C. |
| Appearance: | clear slightly yellow liquid |
| Specification: | clear colorless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
