| Identification | |
| Name: | 1,4-benzenedimethanethiol |
| Synonyms: | 1,4-Benzene dimethanethiol; p-xylene-alpha,alpha-dithiol; 1,4-Bis(mercaptomethyl)benzene |
| CAS: | 105-09-9 |
| EINECS: | 203-269-4 |
| Molecular Formula: | C8H10S2 |
| Molecular Weight: | 170.28 |
| InChI: | InChI=1/C8H10S2/c9-5-7-1-2-8(6-10)4-3-7/h1-4,9-10H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 50 - 55 C |
| Boiling Point: | 156 C at 12 mm Hg |
| Density: | 1.134g/cm3 |
| Refractive index: | 1.607 |
| Solubility: |
Appearance:white
to pale
yellow powder Transport Information: OTH Hazard Symbols:not regulated UN NO. |
| Appearance: | white to pale yellow powder |
| Specification: |
1,4-Benzenedimethanethiol (CAS NO.105-09-9), its Synonyms are 1,4-Benzenebis(methanethiol) ; 1,4-Bis(mercaptomethyl)benzene ; alpha,alpha'-p-Xylenedithiol ; p-Xylylenedithiol ; p-Xylene-alpha,alpha'-dithiol . |
| Safety Data | |
 |
|
